ChemNet > CAS > 18781-31-2 2-Acetyl-3-methylbenzo[b]thiophene
18781-31-2 2-Acetyl-3-methylbenzo[b]thiophene
Nazwa produktu: |
2-Acetyl-3-methylbenzo[b]thiophene |
Angielska nazwa |
2-Acetyl-3-methylbenzo[b]thiophene; 2-Acetyl-3-methylthianaphthene; 1-(3-Methylbenzo[b]thiophen-2-yl)ethan-1-one; 1-(3-methyl-1-benzothiophen-6-yl)ethanone; 1-(3-methyl-1-benzothiophen-2-yl)ethanone |
MF |
C11H10OS |
Masie cząsteczkowej |
190.2615 |
InChI |
InChI=1/C11H10OS/c1-7-9-5-3-4-6-10(9)13-11(7)8(2)12/h3-6H,1-2H3 |
Nr CAS |
18781-31-2 |
Struktury molekularnej |
|
Gęstość |
1.182g/cm3 |
Temperatura topnienia |
79℃ |
Temperatura wrzenia |
319.5°C at 760 mmHg |
Współczynnik załamania |
1.631 |
Temperatura zapłonu |
147°C |
Ciśnienie pary |
0.000337mmHg at 25°C |
Symbole zagrożenia |
|
Kody ryzyka |
|
Bezpieczeństwo opis |
S22:Do not inhale dust.;
S24/25:Avoid contact with skin and eyes.;
|
|